C63H44Br2N2O6S2 — CID 158471085
benzylbenzene;1,6-dibromo-10,10-dioxothioxanthen-9-one;10,10-dioxo-1,6-bis(N-phenylanilino)thioxanthen-9-one (PubChem CID 158471085) has the molecular formula C63H44Br2N2O6S2 and a molecular weight of 1149.00 g/mol. Its IUPAC name is benzylbenzene;1,6-dibromo-10,10-dioxothioxanthen-9-one;10,10-dioxo-1,6-bis(N-phenylanilino)thioxanthen-9-one.
| Compound Name | benzylbenzene;1,6-dibromo-10,10-dioxothioxanthen-9-one;10,10-dioxo-1,6-bis(N-phenylanilino)thioxanthen-9-one |
|---|---|
| PubChem CID | 158471085 |
| Molecular Formula | C63H44Br2N2O6S2 |
| Molecular Weight | 1149.00 g/mol |
| Exact Mass | 1146.10 |
| IUPAC Name | benzylbenzene;1,6-dibromo-10,10-dioxothioxanthen-9-one;10,10-dioxo-1,6-bis(N-phenylanilino)thioxanthen-9-one |
| SMILES | O=C1c2ccc(Br)cc2S(=O)(=O)c2cccc(Br)c21.O=C1c2ccc(N(c3ccccc3)c3ccccc3)cc2S(=O)(=O)c2cccc(N(c3ccccc3)c3ccccc3)c21.c1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C37H26N2O3S.C13H6Br2O3S.C13H12/c40-37-32-25-24-31(38(27-14-5-1-6-15-27)28-16-7-2-8-17-28)26-35(32)43(41,42)34-23-13-22-33(36(34)37)39(29-18-9-3-10-19-29)30-20-11-4-12-21-30;14-7-4-5-8-11(6-7)19(17,18)10-3-1-2-9(15)12(10)13(8)16;1-3-7-12(8-4-1)11-13-9-5-2-6-10-13/h1-26H;1-6H;1-10H,11H2 |
| InChIKey | HGIWUEDRCKWZFA-UHFFFAOYSA-N |
| XLogP | 15.87 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1149.00 |
| LogP ≤ 5 | 15.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |