C26H22BrNSi — CID 170929734
N-(2-bromophenyl)-5,5-dimethyl-N-phenylbenzo[b][1]benzosilol-3-amine (PubChem CID 170929734) has the molecular formula C26H22BrNSi and a molecular weight of 456.46 g/mol. Its IUPAC name is N-(2-bromophenyl)-5,5-dimethyl-N-phenylbenzo[b][1]benzosilol-3-amine.
| Compound Name | N-(2-bromophenyl)-5,5-dimethyl-N-phenylbenzo[b][1]benzosilol-3-amine |
|---|---|
| PubChem CID | 170929734 |
| Molecular Formula | C26H22BrNSi |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | N-(2-bromophenyl)-5,5-dimethyl-N-phenylbenzo[b][1]benzosilol-3-amine |
| SMILES | C[Si]1(C)c2ccccc2-c2ccc(N(c3ccccc3)c3ccccc3Br)cc21 |
| InChI | InChI=1S/C26H22BrNSi/c1-29(2)25-15-9-6-12-21(25)22-17-16-20(18-26(22)29)28(19-10-4-3-5-11-19)24-14-8-7-13-23(24)27/h3-18H,1-2H3 |
| InChIKey | UWYGVZXERQBWKD-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|