C44H37NSi2 — CID 162504511
N-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-5,5-dimethyl-N-(6-phenylnaphthalen-2-yl)benzo[b][1]benzosilol-3-amine (PubChem CID 162504511) has the molecular formula C44H37NSi2 and a molecular weight of 635.96 g/mol. Its IUPAC name is N-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-5,5-dimethyl-N-(6-phenylnaphthalen-2-yl)benzo[b][1]benzosilol-3-amine.
| Compound Name | N-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-5,5-dimethyl-N-(6-phenylnaphthalen-2-yl)benzo[b][1]benzosilol-3-amine |
|---|---|
| PubChem CID | 162504511 |
| Molecular Formula | C44H37NSi2 |
| Molecular Weight | 635.96 g/mol |
| Exact Mass | 635.25 |
| IUPAC Name | N-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-5,5-dimethyl-N-(6-phenylnaphthalen-2-yl)benzo[b][1]benzosilol-3-amine |
| SMILES | C[Si]1(C)c2ccccc2-c2ccc(N(c3ccc4c(c3)[Si](C)(C)c3ccccc3-4)c3ccc4cc(-c5ccccc5)ccc4c3)cc21 |
| InChI | InChI=1S/C44H37NSi2/c1-46(2)41-16-10-8-14-37(41)39-24-22-35(28-43(39)46)45(36-23-25-40-38-15-9-11-17-42(38)47(3,4)44(40)29-36)34-21-20-32-26-31(18-19-33(32)27-34)30-12-6-5-7-13-30/h5-29H,1-4H3 |
| InChIKey | CRDDNRBQZYNTNA-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.96 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|