C46H39NSi2 — CID 162504528
N-(5,5-dimethylbenzo[b][1]benzosilol-1-yl)-5,5-dimethyl-8-phenyl-N-(4-phenylphenyl)benzo[b][1]benzosilol-3-amine (PubChem CID 162504528) has the molecular formula C46H39NSi2 and a molecular weight of 662.00 g/mol. Its IUPAC name is N-(5,5-dimethylbenzo[b][1]benzosilol-1-yl)-5,5-dimethyl-8-phenyl-N-(4-phenylphenyl)benzo[b][1]benzosilol-3-amine.
| Compound Name | N-(5,5-dimethylbenzo[b][1]benzosilol-1-yl)-5,5-dimethyl-8-phenyl-N-(4-phenylphenyl)benzo[b][1]benzosilol-3-amine |
|---|---|
| PubChem CID | 162504528 |
| Molecular Formula | C46H39NSi2 |
| Molecular Weight | 662.00 g/mol |
| Exact Mass | 661.26 |
| IUPAC Name | N-(5,5-dimethylbenzo[b][1]benzosilol-1-yl)-5,5-dimethyl-8-phenyl-N-(4-phenylphenyl)benzo[b][1]benzosilol-3-amine |
| SMILES | C[Si]1(C)c2ccc(-c3ccccc3)cc2-c2ccc(N(c3ccc(-c4ccccc4)cc3)c3cccc4c3-c3ccccc3[Si]4(C)C)cc21 |
| InChI | InChI=1S/C46H39NSi2/c1-48(2)42-20-12-11-18-39(42)46-41(19-13-21-44(46)48)47(36-25-22-34(23-26-36)32-14-7-5-8-15-32)37-27-28-38-40-30-35(33-16-9-6-10-17-33)24-29-43(40)49(3,4)45(38)31-37/h5-31H,1-4H3 |
| InChIKey | QOEISVNTBLIGNV-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.00 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|