C41H35NSi — CID 176605592
N-(9,9-dimethylfluoren-4-yl)-5,5-dimethyl-N-(4-phenylphenyl)benzo[b][1]benzosilol-3-amine (PubChem CID 176605592) has the molecular formula C41H35NSi and a molecular weight of 569.82 g/mol. Its IUPAC name is N-(9,9-dimethylfluoren-4-yl)-5,5-dimethyl-N-(4-phenylphenyl)benzo[b][1]benzosilol-3-amine.
| Compound Name | N-(9,9-dimethylfluoren-4-yl)-5,5-dimethyl-N-(4-phenylphenyl)benzo[b][1]benzosilol-3-amine |
|---|---|
| PubChem CID | 176605592 |
| Molecular Formula | C41H35NSi |
| Molecular Weight | 569.82 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | N-(9,9-dimethylfluoren-4-yl)-5,5-dimethyl-N-(4-phenylphenyl)benzo[b][1]benzosilol-3-amine |
| SMILES | CC1(C)c2ccccc2-c2c(N(c3ccc(-c4ccccc4)cc3)c3ccc4c(c3)[Si](C)(C)c3ccccc3-4)cccc21 |
| InChI | InChI=1S/C41H35NSi/c1-41(2)35-17-10-8-16-34(35)40-36(41)18-12-19-37(40)42(30-23-21-29(22-24-30)28-13-6-5-7-14-28)31-25-26-33-32-15-9-11-20-38(32)43(3,4)39(33)27-31/h5-27H,1-4H3 |
| InChIKey | KTGJMJQLZLILOD-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.82 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|