C50H41NSi2 — CID 162504651
N-(5,5-dimethylbenzo[b][1]benzosilol-1-yl)-5,5-dimethyl-7-naphthalen-2-yl-N-(4-phenylphenyl)benzo[b][1]benzosilol-3-amine (PubChem CID 162504651) has the molecular formula C50H41NSi2 and a molecular weight of 712.06 g/mol. Its IUPAC name is N-(5,5-dimethylbenzo[b][1]benzosilol-1-yl)-5,5-dimethyl-7-naphthalen-2-yl-N-(4-phenylphenyl)benzo[b][1]benzosilol-3-amine.
| Compound Name | N-(5,5-dimethylbenzo[b][1]benzosilol-1-yl)-5,5-dimethyl-7-naphthalen-2-yl-N-(4-phenylphenyl)benzo[b][1]benzosilol-3-amine |
|---|---|
| PubChem CID | 162504651 |
| Molecular Formula | C50H41NSi2 |
| Molecular Weight | 712.06 g/mol |
| Exact Mass | 711.28 |
| IUPAC Name | N-(5,5-dimethylbenzo[b][1]benzosilol-1-yl)-5,5-dimethyl-7-naphthalen-2-yl-N-(4-phenylphenyl)benzo[b][1]benzosilol-3-amine |
| SMILES | C[Si]1(C)c2cc(-c3ccc4ccccc4c3)ccc2-c2ccc(N(c3ccc(-c4ccccc4)cc3)c3cccc4c3-c3ccccc3[Si]4(C)C)cc21 |
| InChI | InChI=1S/C50H41NSi2/c1-52(2)46-19-11-10-17-44(46)50-45(18-12-20-47(50)52)51(40-26-23-36(24-27-40)34-13-6-5-7-14-34)41-28-30-43-42-29-25-39(32-48(42)53(3,4)49(43)33-41)38-22-21-35-15-8-9-16-37(35)31-38/h5-33H,1-4H3 |
| InChIKey | LPOJVKSJPMEVHJ-UHFFFAOYSA-N |
| XLogP | 11.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.06 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|