C73H67NO2S — CID 59972652
7-[bis[3-(2-phenylpropan-2-yl)phenyl]methyl]-5,5-dioxo-N,N-bis[3-(2-phenylpropan-2-yl)phenyl]dibenzothiophen-3-amine (PubChem CID 59972652) has the molecular formula C73H67NO2S and a molecular weight of 1022.41 g/mol. Its IUPAC name is 7-[bis[3-(2-phenylpropan-2-yl)phenyl]methyl]-5,5-dioxo-N,N-bis[3-(2-phenylpropan-2-yl)phenyl]dibenzothiophen-3-amine.
| Compound Name | 7-[bis[3-(2-phenylpropan-2-yl)phenyl]methyl]-5,5-dioxo-N,N-bis[3-(2-phenylpropan-2-yl)phenyl]dibenzothiophen-3-amine |
|---|---|
| PubChem CID | 59972652 |
| Molecular Formula | C73H67NO2S |
| Molecular Weight | 1022.41 g/mol |
| Exact Mass | 1021.49 |
| IUPAC Name | 7-[bis[3-(2-phenylpropan-2-yl)phenyl]methyl]-5,5-dioxo-N,N-bis[3-(2-phenylpropan-2-yl)phenyl]dibenzothiophen-3-amine |
| SMILES | CC(C)(c1ccccc1)c1cccc(C(c2cccc(C(C)(C)c3ccccc3)c2)c2ccc3c(c2)S(=O)(=O)c2cc(N(c4cccc(C(C)(C)c5ccccc5)c4)c4cccc(C(C)(C)c5ccccc5)c4)ccc2-3)c1 |
| InChI | InChI=1S/C73H67NO2S/c1-70(2,54-27-13-9-14-28-54)58-35-21-25-51(45-58)69(52-26-22-36-59(46-52)71(3,4)55-29-15-10-16-30-55)53-41-43-65-66-44-42-64(50-68(66)77(75,76)67(65)47-53)74(62-39-23-37-60(48-62)72(5,6)56-31-17-11-18-32-56)63-40-24-38-61(49-63)73(7,8)57-33-19-12-20-34-57/h9-50,69H,1-8H3 |
| InChIKey | KGDZBRISOPLWIS-UHFFFAOYSA-N |
| XLogP | 18.45 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1022.41 |
| LogP ≤ 5 | 18.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|