C36H26N2O2S — CID 153472839
5,5-dioxo-3-N,3-N,7-N,7-N-tetraphenyldibenzothiophene-3,7-diamine (PubChem CID 153472839) has the molecular formula C36H26N2O2S and a molecular weight of 550.68 g/mol. Its IUPAC name is 5,5-dioxo-3-N,3-N,7-N,7-N-tetraphenyldibenzothiophene-3,7-diamine.
| Compound Name | 5,5-dioxo-3-N,3-N,7-N,7-N-tetraphenyldibenzothiophene-3,7-diamine |
|---|---|
| PubChem CID | 153472839 |
| Molecular Formula | C36H26N2O2S |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | 5,5-dioxo-3-N,3-N,7-N,7-N-tetraphenyldibenzothiophene-3,7-diamine |
| SMILES | O=S1(=O)c2cc(N(c3ccccc3)c3ccccc3)ccc2-c2ccc(N(c3ccccc3)c3ccccc3)cc21 |
| InChI | InChI=1S/C36H26N2O2S/c39-41(40)35-25-31(37(27-13-5-1-6-14-27)28-15-7-2-8-16-28)21-23-33(35)34-24-22-32(26-36(34)41)38(29-17-9-3-10-18-29)30-19-11-4-12-20-30/h1-26H |
| InChIKey | YSFYAEAHAYTDSP-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |