C66H42N2O4S2 — CID 145330692
5-N,8-N-bis(5,5-dioxo-6-phenyldibenzothiophen-3-yl)-5-N,8-N-diphenylbenzo[c]phenanthrene-5,8-diamine (PubChem CID 145330692) has the molecular formula C66H42N2O4S2 and a molecular weight of 991.21 g/mol. Its IUPAC name is 5-N,8-N-bis(5,5-dioxo-6-phenyldibenzothiophen-3-yl)-5-N,8-N-diphenylbenzo[c]phenanthrene-5,8-diamine.
| Compound Name | 5-N,8-N-bis(5,5-dioxo-6-phenyldibenzothiophen-3-yl)-5-N,8-N-diphenylbenzo[c]phenanthrene-5,8-diamine |
|---|---|
| PubChem CID | 145330692 |
| Molecular Formula | C66H42N2O4S2 |
| Molecular Weight | 991.21 g/mol |
| Exact Mass | 990.26 |
| IUPAC Name | 5-N,8-N-bis(5,5-dioxo-6-phenyldibenzothiophen-3-yl)-5-N,8-N-diphenylbenzo[c]phenanthrene-5,8-diamine |
| SMILES | O=S1(=O)c2cc(N(c3ccccc3)c3cc4cc(N(c5ccccc5)c5ccc6c(c5)S(=O)(=O)c5c(-c7ccccc7)cccc5-6)c5ccccc5c4c4ccccc34)ccc2-c2cccc(-c3ccccc3)c21 |
| InChI | InChI=1S/C66H42N2O4S2/c69-73(70)62-41-48(35-37-54(62)58-33-17-31-50(65(58)73)43-19-5-1-6-20-43)67(46-23-9-3-10-24-46)60-39-45-40-61(53-28-14-16-30-57(53)64(45)56-29-15-13-27-52(56)60)68(47-25-11-4-12-26-47)49-36-38-55-59-34-18-32-51(44-21-7-2-8-22-44)66(59)74(71,72)63(55)42-49/h1-42H |
| InChIKey | ZXIBDHLQEBGUNU-UHFFFAOYSA-N |
| XLogP | 17.05 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 991.21 |
| LogP ≤ 5 | 17.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|