C30H22NO2PS — CID 144851721
5,5-dioxo-N,N,10-triphenylbenzo[b][1,4]benzothiaphosphinin-3-amine (PubChem CID 144851721) has the molecular formula C30H22NO2PS and a molecular weight of 491.55 g/mol. Its IUPAC name is 5,5-dioxo-N,N,10-triphenylbenzo[b][1,4]benzothiaphosphinin-3-amine.
| Compound Name | 5,5-dioxo-N,N,10-triphenylbenzo[b][1,4]benzothiaphosphinin-3-amine |
|---|---|
| PubChem CID | 144851721 |
| Molecular Formula | C30H22NO2PS |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | 5,5-dioxo-N,N,10-triphenylbenzo[b][1,4]benzothiaphosphinin-3-amine |
| SMILES | O=S1(=O)c2ccccc2P(c2ccccc2)c2ccc(N(c3ccccc3)c3ccccc3)cc21 |
| InChI | InChI=1S/C30H22NO2PS/c32-35(33)29-19-11-10-18-27(29)34(26-16-8-3-9-17-26)28-21-20-25(22-30(28)35)31(23-12-4-1-5-13-23)24-14-6-2-7-15-24/h1-22H |
| InChIKey | DCHBUDLMUPUGQB-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|