C33H35NO2S — CID 167473203
3,7-bis(2-phenylpropan-2-yl)-10-propan-2-ylphenothiazine 5,5-dioxide (PubChem CID 167473203) has the molecular formula C33H35NO2S and a molecular weight of 509.72 g/mol. Its IUPAC name is 3,7-bis(2-phenylpropan-2-yl)-10-propan-2-ylphenothiazine 5,5-dioxide.
| Compound Name | 3,7-bis(2-phenylpropan-2-yl)-10-propan-2-ylphenothiazine 5,5-dioxide |
|---|---|
| PubChem CID | 167473203 |
| Molecular Formula | C33H35NO2S |
| Molecular Weight | 509.72 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | 3,7-bis(2-phenylpropan-2-yl)-10-propan-2-ylphenothiazine 5,5-dioxide |
| SMILES | CC(C)N1c2ccc(C(C)(C)c3ccccc3)cc2S(=O)(=O)c2cc(C(C)(C)c3ccccc3)ccc21 |
| InChI | InChI=1S/C33H35NO2S/c1-23(2)34-28-19-17-26(32(3,4)24-13-9-7-10-14-24)21-30(28)37(35,36)31-22-27(18-20-29(31)34)33(5,6)25-15-11-8-12-16-25/h7-23H,1-6H3 |
| InChIKey | LWRZZWCRPQYTLK-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.72 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |