C27H31NO2S — CID 139529071
3,7-ditert-butyl-10-(4-methylphenyl)phenothiazine 5,5-dioxide (PubChem CID 139529071) has the molecular formula C27H31NO2S and a molecular weight of 433.62 g/mol. Its IUPAC name is 3,7-ditert-butyl-10-(4-methylphenyl)phenothiazine 5,5-dioxide.
| Compound Name | 3,7-ditert-butyl-10-(4-methylphenyl)phenothiazine 5,5-dioxide |
|---|---|
| PubChem CID | 139529071 |
| Molecular Formula | C27H31NO2S |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 3,7-ditert-butyl-10-(4-methylphenyl)phenothiazine 5,5-dioxide |
| SMILES | Cc1ccc(N2c3ccc(C(C)(C)C)cc3S(=O)(=O)c3cc(C(C)(C)C)ccc32)cc1 |
| InChI | InChI=1S/C27H31NO2S/c1-18-8-12-21(13-9-18)28-22-14-10-19(26(2,3)4)16-24(22)31(29,30)25-17-20(27(5,6)7)11-15-23(25)28/h8-17H,1-7H3 |
| InChIKey | DGRUZLWCWKTRNQ-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |