C23H23NO5S — CID 59572770
3,7-dimethyl-10-(2,4,6-trimethoxyphenyl)phenothiazine 5,5-dioxide (PubChem CID 59572770) has the molecular formula C23H23NO5S and a molecular weight of 425.51 g/mol. Its IUPAC name is 3,7-dimethyl-10-(2,4,6-trimethoxyphenyl)phenothiazine 5,5-dioxide.
| Compound Name | 3,7-dimethyl-10-(2,4,6-trimethoxyphenyl)phenothiazine 5,5-dioxide |
|---|---|
| PubChem CID | 59572770 |
| Molecular Formula | C23H23NO5S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 3,7-dimethyl-10-(2,4,6-trimethoxyphenyl)phenothiazine 5,5-dioxide |
| SMILES | COc1cc(OC)c(N2c3ccc(C)cc3S(=O)(=O)c3cc(C)ccc32)c(OC)c1 |
| InChI | InChI=1S/C23H23NO5S/c1-14-6-8-17-21(10-14)30(25,26)22-11-15(2)7-9-18(22)24(17)23-19(28-4)12-16(27-3)13-20(23)29-5/h6-13H,1-5H3 |
| InChIKey | OMPRXCYKCJAHHI-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |