About 2-(2,4-dimethylphenyl)sulfanyl-1,3,5-trimethoxybenzene
2-(2,4-dimethylphenyl)sulfanyl-1,3,5-trimethoxybenzene (PubChem CID 135030855) has the molecular formula C17H20O3S
and a molecular weight of 304.41 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)sulfanyl-1,3,5-trimethoxybenzene.
Molecular Properties
| Compound Name | 2-(2,4-dimethylphenyl)sulfanyl-1,3,5-trimethoxybenzene |
| PubChem CID | 135030855 |
| Molecular Formula | C17H20O3S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 2-(2,4-dimethylphenyl)sulfanyl-1,3,5-trimethoxybenzene |
| SMILES | COc1cc(OC)c(Sc2ccc(C)cc2C)c(OC)c1 |
| InChI | InChI=1S/C17H20O3S/c1-11-6-7-16(12(2)8-11)21-17-14(19-4)9-13(18-3)10-15(17)20-5/h6-10H,1-5H3 |
| InChIKey | DLFCYFJOERMRCO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,4-dimethylphenyl)sulfanyl-1,3,5-trimethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dimethylphenyl)sulfanyl-1,3,5-trimethoxybenzene?
The IUPAC name of 2-(2,4-dimethylphenyl)sulfanyl-1,3,5-trimethoxybenzene (CID 135030855) is 2-(2,4-dimethylphenyl)sulfanyl-1,3,5-trimethoxybenzene.
What is the SMILES notation for 2-(2,4-dimethylphenyl)sulfanyl-1,3,5-trimethoxybenzene?
The canonical SMILES for 2-(2,4-dimethylphenyl)sulfanyl-1,3,5-trimethoxybenzene is COc1cc(OC)c(Sc2ccc(C)cc2C)c(OC)c1.
What is the InChIKey of 2-(2,4-dimethylphenyl)sulfanyl-1,3,5-trimethoxybenzene?
The InChIKey is DLFCYFJOERMRCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O3S/c1-11-6-7-16(12(2)8-11)21-17-14(19-4)9-13(18-3)10-15(17)20-5/h6-10H,1-5H3.
What are the key properties of 2-(2,4-dimethylphenyl)sulfanyl-1,3,5-trimethoxybenzene?
2-(2,4-dimethylphenyl)sulfanyl-1,3,5-trimethoxybenzene has a molecular weight of 304.41 g/mol, XLogP of 4.48, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dimethylphenyl)sulfanyl-1,3,5-trimethoxybenzene is sourced from PubChem (CID 135030855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).