C22H22N2OS2 — CID 18226262
1-[4-(2,4-dimethylphenyl)sulfanylphenyl]-3-(4-methoxyphenyl)thiourea (PubChem CID 18226262) has the molecular formula C22H22N2OS2 and a molecular weight of 394.57 g/mol. Its IUPAC name is 1-[4-(2,4-dimethylphenyl)sulfanylphenyl]-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[4-(2,4-dimethylphenyl)sulfanylphenyl]-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 18226262 |
| Molecular Formula | C22H22N2OS2 |
| Molecular Weight | 394.57 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 1-[4-(2,4-dimethylphenyl)sulfanylphenyl]-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)Nc2ccc(Sc3ccc(C)cc3C)cc2)cc1 |
| InChI | InChI=1S/C22H22N2OS2/c1-15-4-13-21(16(2)14-15)27-20-11-7-18(8-12-20)24-22(26)23-17-5-9-19(25-3)10-6-17/h4-14H,1-3H3,(H2,23,24,26) |
| InChIKey | RPKLXYWHDQDCTR-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.57 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|