C16H18N2S2 — CID 8679323
1-[4-(2,4-dimethylphenyl)sulfanylphenyl]-3-methylthiourea (PubChem CID 8679323) has the molecular formula C16H18N2S2 and a molecular weight of 302.47 g/mol. Its IUPAC name is 1-[4-(2,4-dimethylphenyl)sulfanylphenyl]-3-methylthiourea.
| Compound Name | 1-[4-(2,4-dimethylphenyl)sulfanylphenyl]-3-methylthiourea |
|---|---|
| PubChem CID | 8679323 |
| Molecular Formula | C16H18N2S2 |
| Molecular Weight | 302.47 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 1-[4-(2,4-dimethylphenyl)sulfanylphenyl]-3-methylthiourea |
| SMILES | CNC(=S)Nc1ccc(Sc2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C16H18N2S2/c1-11-4-9-15(12(2)10-11)20-14-7-5-13(6-8-14)18-16(19)17-3/h4-10H,1-3H3,(H2,17,18,19) |
| InChIKey | QZKBJVFJFNTZDL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|