C27H24N4O2S — CID 162701118
4-amino-N-[4-[4-[(4-aminobenzoyl)amino]-2-methylphenyl]sulfanylphenyl]benzamide (PubChem CID 162701118) has the molecular formula C27H24N4O2S and a molecular weight of 468.58 g/mol. Its IUPAC name is 4-amino-N-[4-[4-[(4-aminobenzoyl)amino]-2-methylphenyl]sulfanylphenyl]benzamide.
| Compound Name | 4-amino-N-[4-[4-[(4-aminobenzoyl)amino]-2-methylphenyl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 162701118 |
| Molecular Formula | C27H24N4O2S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 4-amino-N-[4-[4-[(4-aminobenzoyl)amino]-2-methylphenyl]sulfanylphenyl]benzamide |
| SMILES | Cc1cc(NC(=O)c2ccc(N)cc2)ccc1Sc1ccc(NC(=O)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C27H24N4O2S/c1-17-16-23(31-27(33)19-4-8-21(29)9-5-19)12-15-25(17)34-24-13-10-22(11-14-24)30-26(32)18-2-6-20(28)7-3-18/h2-16H,28-29H2,1H3,(H,30,32)(H,31,33) |
| InChIKey | IWQLVIGAXWHOSG-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|