C23H21FN2O2S — CID 60567516
3-acetamido-N-[4-(2,4-dimethylphenyl)sulfanylphenyl]-4-fluorobenzamide (PubChem CID 60567516) has the molecular formula C23H21FN2O2S and a molecular weight of 408.50 g/mol. Its IUPAC name is 3-acetamido-N-[4-(2,4-dimethylphenyl)sulfanylphenyl]-4-fluorobenzamide.
| Compound Name | 3-acetamido-N-[4-(2,4-dimethylphenyl)sulfanylphenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 60567516 |
| Molecular Formula | C23H21FN2O2S |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 3-acetamido-N-[4-(2,4-dimethylphenyl)sulfanylphenyl]-4-fluorobenzamide |
| SMILES | CC(=O)Nc1cc(C(=O)Nc2ccc(Sc3ccc(C)cc3C)cc2)ccc1F |
| InChI | InChI=1S/C23H21FN2O2S/c1-14-4-11-22(15(2)12-14)29-19-8-6-18(7-9-19)26-23(28)17-5-10-20(24)21(13-17)25-16(3)27/h4-13H,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | KJDGNCIJOIOFNR-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |