C17H14FN5O2 — CID 56787182
3-acetamido-4-fluoro-N-[4-(1H-1,2,4-triazol-5-yl)phenyl]benzamide (PubChem CID 56787182) has the molecular formula C17H14FN5O2 and a molecular weight of 339.33 g/mol. Its IUPAC name is 3-acetamido-4-fluoro-N-[4-(1H-1,2,4-triazol-5-yl)phenyl]benzamide.
| Compound Name | 3-acetamido-4-fluoro-N-[4-(1H-1,2,4-triazol-5-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 56787182 |
| Molecular Formula | C17H14FN5O2 |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 3-acetamido-4-fluoro-N-[4-(1H-1,2,4-triazol-5-yl)phenyl]benzamide |
| SMILES | CC(=O)Nc1cc(C(=O)Nc2ccc(-c3ncn[nH]3)cc2)ccc1F |
| InChI | InChI=1S/C17H14FN5O2/c1-10(24)21-15-8-12(4-7-14(15)18)17(25)22-13-5-2-11(3-6-13)16-19-9-20-23-16/h2-9H,1H3,(H,21,24)(H,22,25)(H,19,20,23) |
| InChIKey | BTECBRNSLOVUBP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |