C19H16N4O3 — CID 75534687
methyl 4-[(E)-3-oxo-3-[4-(1H-1,2,4-triazol-5-yl)anilino]prop-1-enyl]benzoate (PubChem CID 75534687) has the molecular formula C19H16N4O3 and a molecular weight of 348.36 g/mol. Its IUPAC name is methyl 4-[(E)-3-oxo-3-[4-(1H-1,2,4-triazol-5-yl)anilino]prop-1-enyl]benzoate.
| Compound Name | methyl 4-[(E)-3-oxo-3-[4-(1H-1,2,4-triazol-5-yl)anilino]prop-1-enyl]benzoate |
|---|---|
| PubChem CID | 75534687 |
| Molecular Formula | C19H16N4O3 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | methyl 4-[(E)-3-oxo-3-[4-(1H-1,2,4-triazol-5-yl)anilino]prop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C/C(=O)Nc2ccc(-c3ncn[nH]3)cc2)cc1 |
| InChI | InChI=1S/C19H16N4O3/c1-26-19(25)15-5-2-13(3-6-15)4-11-17(24)22-16-9-7-14(8-10-16)18-20-12-21-23-18/h2-12H,1H3,(H,22,24)(H,20,21,23)/b11-4+ |
| InChIKey | FCIDROWNMSKRPM-NYYWCZLTSA-N |
| XLogP | 2.91 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|