C20H19N3O3 — CID 76879130
3-(3,5-dimethoxyphenyl)-N-[4-(1H-imidazol-2-yl)phenyl]prop-2-enamide (PubChem CID 76879130) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is 3-(3,5-dimethoxyphenyl)-N-[4-(1H-imidazol-2-yl)phenyl]prop-2-enamide.
| Compound Name | 3-(3,5-dimethoxyphenyl)-N-[4-(1H-imidazol-2-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 76879130 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 3-(3,5-dimethoxyphenyl)-N-[4-(1H-imidazol-2-yl)phenyl]prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)Nc2ccc(-c3ncc[nH]3)cc2)cc(OC)c1 |
| InChI | InChI=1S/C20H19N3O3/c1-25-17-11-14(12-18(13-17)26-2)3-8-19(24)23-16-6-4-15(5-7-16)20-21-9-10-22-20/h3-13H,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | PAFODQCWLKIKBQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|