C13H13N3O — CID 110470252
(E)-N-[4-(1H-imidazol-2-yl)phenyl]but-2-enamide (PubChem CID 110470252) has the molecular formula C13H13N3O and a molecular weight of 227.27 g/mol. Its IUPAC name is (E)-N-[4-(1H-imidazol-2-yl)phenyl]but-2-enamide.
| Compound Name | (E)-N-[4-(1H-imidazol-2-yl)phenyl]but-2-enamide |
|---|---|
| PubChem CID | 110470252 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | (E)-N-[4-(1H-imidazol-2-yl)phenyl]but-2-enamide |
| SMILES | C/C=C/C(=O)Nc1ccc(-c2ncc[nH]2)cc1 |
| InChI | InChI=1S/C13H13N3O/c1-2-3-12(17)16-11-6-4-10(5-7-11)13-14-8-9-15-13/h2-9H,1H3,(H,14,15)(H,16,17)/b3-2+ |
| InChIKey | RUHSBWSCDQMPNP-NSCUHMNNSA-N |
| XLogP | 2.59 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|