C20H22N2O5 — CID 46568433
(E)-3-(3,5-dimethoxyphenyl)-N-[4-[(2-methoxyacetyl)amino]phenyl]prop-2-enamide (PubChem CID 46568433) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is (E)-3-(3,5-dimethoxyphenyl)-N-[4-[(2-methoxyacetyl)amino]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3,5-dimethoxyphenyl)-N-[4-[(2-methoxyacetyl)amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 46568433 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | (E)-3-(3,5-dimethoxyphenyl)-N-[4-[(2-methoxyacetyl)amino]phenyl]prop-2-enamide |
| SMILES | COCC(=O)Nc1ccc(NC(=O)/C=C/c2cc(OC)cc(OC)c2)cc1 |
| InChI | InChI=1S/C20H22N2O5/c1-25-13-20(24)22-16-7-5-15(6-8-16)21-19(23)9-4-14-10-17(26-2)12-18(11-14)27-3/h4-12H,13H2,1-3H3,(H,21,23)(H,22,24)/b9-4+ |
| InChIKey | GUIBRUPZYALYIS-RUDMXATFSA-N |
| XLogP | 2.94 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|