About N-[2-fluoro-5-(1H-1,2,4-triazol-5-yl)phenyl]cyclopropanecarboxamide
N-[2-fluoro-5-(1H-1,2,4-triazol-5-yl)phenyl]cyclopropanecarboxamide (PubChem CID 166218163) has the molecular formula C12H11FN4O
and a molecular weight of 246.25 g/mol. Its IUPAC name is N-[2-fluoro-5-(1H-1,2,4-triazol-5-yl)phenyl]cyclopropanecarboxamide.
Molecular Properties
| Compound Name | N-[2-fluoro-5-(1H-1,2,4-triazol-5-yl)phenyl]cyclopropanecarboxamide |
| PubChem CID | 166218163 |
| Molecular Formula | C12H11FN4O |
| Molecular Weight | 246.25 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | N-[2-fluoro-5-(1H-1,2,4-triazol-5-yl)phenyl]cyclopropanecarboxamide |
| SMILES | O=C(Nc1cc(-c2ncn[nH]2)ccc1F)C1CC1 |
| InChI | InChI=1S/C12H11FN4O/c13-9-4-3-8(11-14-6-15-17-11)5-10(9)16-12(18)7-1-2-7/h3-7H,1-2H2,(H,16,18)(H,14,15,17) |
| InChIKey | WSFJYQFEOYBWSL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-fluoro-5-(1H-1,2,4-triazol-5-yl)phenyl]cyclopropanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-fluoro-5-(1H-1,2,4-triazol-5-yl)phenyl]cyclopropanecarboxamide?
The IUPAC name of N-[2-fluoro-5-(1H-1,2,4-triazol-5-yl)phenyl]cyclopropanecarboxamide (CID 166218163) is N-[2-fluoro-5-(1H-1,2,4-triazol-5-yl)phenyl]cyclopropanecarboxamide.
What is the SMILES notation for N-[2-fluoro-5-(1H-1,2,4-triazol-5-yl)phenyl]cyclopropanecarboxamide?
The canonical SMILES for N-[2-fluoro-5-(1H-1,2,4-triazol-5-yl)phenyl]cyclopropanecarboxamide is O=C(Nc1cc(-c2ncn[nH]2)ccc1F)C1CC1.
What is the InChIKey of N-[2-fluoro-5-(1H-1,2,4-triazol-5-yl)phenyl]cyclopropanecarboxamide?
The InChIKey is WSFJYQFEOYBWSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11FN4O/c13-9-4-3-8(11-14-6-15-17-11)5-10(9)16-12(18)7-1-2-7/h3-7H,1-2H2,(H,16,18)(H,14,15,17).
What are the key properties of N-[2-fluoro-5-(1H-1,2,4-triazol-5-yl)phenyl]cyclopropanecarboxamide?
N-[2-fluoro-5-(1H-1,2,4-triazol-5-yl)phenyl]cyclopropanecarboxamide has a molecular weight of 246.25 g/mol, XLogP of 1.96, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-fluoro-5-(1H-1,2,4-triazol-5-yl)phenyl]cyclopropanecarboxamide is sourced from PubChem (CID 166218163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).