C17H12FN3O4 — CID 99804576
N-(3-acetamido-4-fluorophenyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 99804576) has the molecular formula C17H12FN3O4 and a molecular weight of 341.30 g/mol. Its IUPAC name is N-(3-acetamido-4-fluorophenyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-(3-acetamido-4-fluorophenyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 99804576 |
| Molecular Formula | C17H12FN3O4 |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | N-(3-acetamido-4-fluorophenyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CC(=O)Nc1cc(NC(=O)c2ccc3c(c2)C(=O)NC3=O)ccc1F |
| InChI | InChI=1S/C17H12FN3O4/c1-8(22)19-14-7-10(3-5-13(14)18)20-15(23)9-2-4-11-12(6-9)17(25)21-16(11)24/h2-7H,1H3,(H,19,22)(H,20,23)(H,21,24,25) |
| InChIKey | BMDDVAKRVOABHZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|