C20H21N3O2S — CID 143790506
4-amino-N-[4-[(2-oxo-1H-pyridin-4-yl)sulfanyl]phenyl]benzamide;ethane (PubChem CID 143790506) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is 4-amino-N-[4-[(2-oxo-1H-pyridin-4-yl)sulfanyl]phenyl]benzamide;ethane.
| Compound Name | 4-amino-N-[4-[(2-oxo-1H-pyridin-4-yl)sulfanyl]phenyl]benzamide;ethane |
|---|---|
| PubChem CID | 143790506 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 4-amino-N-[4-[(2-oxo-1H-pyridin-4-yl)sulfanyl]phenyl]benzamide;ethane |
| SMILES | CC.Nc1ccc(C(=O)Nc2ccc(Sc3cc[nH]c(=O)c3)cc2)cc1 |
| InChI | InChI=1S/C18H15N3O2S.C2H6/c19-13-3-1-12(2-4-13)18(23)21-14-5-7-15(8-6-14)24-16-9-10-20-17(22)11-16;1-2/h1-11H,19H2,(H,20,22)(H,21,23);1-2H3 |
| InChIKey | MCPSKQICXGJGJW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|