C7H4FNO4S — CID 174810630
4-fluoro-2-hydroxy-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 174810630) has the molecular formula C7H4FNO4S and a molecular weight of 217.18 g/mol. Its IUPAC name is 4-fluoro-2-hydroxy-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 4-fluoro-2-hydroxy-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 174810630 |
| Molecular Formula | C7H4FNO4S |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 216.98 |
| IUPAC Name | 4-fluoro-2-hydroxy-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | O=C1c2c(F)cccc2S(=O)(=O)N1O |
| InChI | InChI=1S/C7H4FNO4S/c8-4-2-1-3-5-6(4)7(10)9(11)14(5,12)13/h1-3,11H |
| InChIKey | WSENPKBGTXHSRD-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|