C10H7FO3S — CID 117194808
2-(4-fluoro-1,1-dioxo-1-benzothiophen-3-yl)acetaldehyde (PubChem CID 117194808) has the molecular formula C10H7FO3S and a molecular weight of 226.23 g/mol. Its IUPAC name is 2-(4-fluoro-1,1-dioxo-1-benzothiophen-3-yl)acetaldehyde.
| Compound Name | 2-(4-fluoro-1,1-dioxo-1-benzothiophen-3-yl)acetaldehyde |
|---|---|
| PubChem CID | 117194808 |
| Molecular Formula | C10H7FO3S |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | 2-(4-fluoro-1,1-dioxo-1-benzothiophen-3-yl)acetaldehyde |
| SMILES | O=CCC1=CS(=O)(=O)c2cccc(F)c21 |
| InChI | InChI=1S/C10H7FO3S/c11-8-2-1-3-9-10(8)7(4-5-12)6-15(9,13)14/h1-3,5-6H,4H2 |
| InChIKey | PJAPPOCURHNOLC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|