C9H5FO4S — CID 117119449
4-fluoro-1,1-dioxo-1-benzothiophene-3-carboxylic acid (PubChem CID 117119449) has the molecular formula C9H5FO4S and a molecular weight of 228.20 g/mol. Its IUPAC name is 4-fluoro-1,1-dioxo-1-benzothiophene-3-carboxylic acid.
| Compound Name | 4-fluoro-1,1-dioxo-1-benzothiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 117119449 |
| Molecular Formula | C9H5FO4S |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 227.99 |
| IUPAC Name | 4-fluoro-1,1-dioxo-1-benzothiophene-3-carboxylic acid |
| SMILES | O=C(O)C1=CS(=O)(=O)c2cccc(F)c21 |
| InChI | InChI=1S/C9H5FO4S/c10-6-2-1-3-7-8(6)5(9(11)12)4-15(7,13)14/h1-4H,(H,11,12) |
| InChIKey | HEXCNYXLVGMYBZ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |