C11H12O3S — CID 117119383
1-(4-methyl-1,1-dioxo-1-benzothiophen-3-yl)ethanol (PubChem CID 117119383) has the molecular formula C11H12O3S and a molecular weight of 224.28 g/mol. Its IUPAC name is 1-(4-methyl-1,1-dioxo-1-benzothiophen-3-yl)ethanol.
| Compound Name | 1-(4-methyl-1,1-dioxo-1-benzothiophen-3-yl)ethanol |
|---|---|
| PubChem CID | 117119383 |
| Molecular Formula | C11H12O3S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 1-(4-methyl-1,1-dioxo-1-benzothiophen-3-yl)ethanol |
| SMILES | Cc1cccc2c1C(C(C)O)=CS2(=O)=O |
| InChI | InChI=1S/C11H12O3S/c1-7-4-3-5-10-11(7)9(8(2)12)6-15(10,13)14/h3-6,8,12H,1-2H3 |
| InChIKey | QDHXEVQXJRDGQZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |