C11H13NO3S — CID 84701326
1-(1,1-dioxo-1-benzothiophen-3-yl)-2-(methylamino)ethanol (PubChem CID 84701326) has the molecular formula C11H13NO3S and a molecular weight of 239.30 g/mol. Its IUPAC name is 1-(1,1-dioxo-1-benzothiophen-3-yl)-2-(methylamino)ethanol.
| Compound Name | 1-(1,1-dioxo-1-benzothiophen-3-yl)-2-(methylamino)ethanol |
|---|---|
| PubChem CID | 84701326 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 1-(1,1-dioxo-1-benzothiophen-3-yl)-2-(methylamino)ethanol |
| SMILES | CNCC(O)C1=CS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C11H13NO3S/c1-12-6-10(13)9-7-16(14,15)11-5-3-2-4-8(9)11/h2-5,7,10,12-13H,6H2,1H3 |
| InChIKey | RTNCZDFQDFDONF-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |