C9H6O3S — CID 84665316
1,1-dioxo-1-benzothiophene-3-carbaldehyde (PubChem CID 84665316) has the molecular formula C9H6O3S and a molecular weight of 194.21 g/mol. Its IUPAC name is 1,1-dioxo-1-benzothiophene-3-carbaldehyde.
| Compound Name | 1,1-dioxo-1-benzothiophene-3-carbaldehyde |
|---|---|
| PubChem CID | 84665316 |
| Molecular Formula | C9H6O3S |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.00 |
| IUPAC Name | 1,1-dioxo-1-benzothiophene-3-carbaldehyde |
| SMILES | O=CC1=CS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C9H6O3S/c10-5-7-6-13(11,12)9-4-2-1-3-8(7)9/h1-6H |
| InChIKey | COCYFZOHPZLXBF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|