C15H18O2S — CID 173079688
3-cycloheptyl-1-benzothiophene 1,1-dioxide (PubChem CID 173079688) has the molecular formula C15H18O2S and a molecular weight of 262.37 g/mol. Its IUPAC name is 3-cycloheptyl-1-benzothiophene 1,1-dioxide.
| Compound Name | 3-cycloheptyl-1-benzothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 173079688 |
| Molecular Formula | C15H18O2S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 3-cycloheptyl-1-benzothiophene 1,1-dioxide |
| SMILES | O=S1(=O)C=C(C2CCCCCC2)c2ccccc21 |
| InChI | InChI=1S/C15H18O2S/c16-18(17)11-14(12-7-3-1-2-4-8-12)13-9-5-6-10-15(13)18/h5-6,9-12H,1-4,7-8H2 |
| InChIKey | NFPONSDIRUYDKV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |