C10H9BrO3S — CID 117120815
1-(5-bromo-1,1-dioxo-1-benzothiophen-3-yl)ethanol (PubChem CID 117120815) has the molecular formula C10H9BrO3S and a molecular weight of 289.15 g/mol. Its IUPAC name is 1-(5-bromo-1,1-dioxo-1-benzothiophen-3-yl)ethanol.
| Compound Name | 1-(5-bromo-1,1-dioxo-1-benzothiophen-3-yl)ethanol |
|---|---|
| PubChem CID | 117120815 |
| Molecular Formula | C10H9BrO3S |
| Molecular Weight | 289.15 g/mol |
| Exact Mass | 287.95 |
| IUPAC Name | 1-(5-bromo-1,1-dioxo-1-benzothiophen-3-yl)ethanol |
| SMILES | CC(O)C1=CS(=O)(=O)c2ccc(Br)cc21 |
| InChI | InChI=1S/C10H9BrO3S/c1-6(12)9-5-15(13,14)10-3-2-7(11)4-8(9)10/h2-6,12H,1H3 |
| InChIKey | ZHURDAFNWMWMRO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.15 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |