About 3-(1-aminopropan-2-yl)-1,1-dioxo-1-benzothiophen-5-ol
3-(1-aminopropan-2-yl)-1,1-dioxo-1-benzothiophen-5-ol (PubChem CID 117120895) has the molecular formula C11H13NO3S
and a molecular weight of 239.30 g/mol. Its IUPAC name is 3-(1-aminopropan-2-yl)-1,1-dioxo-1-benzothiophen-5-ol.
Molecular Properties
| Compound Name | 3-(1-aminopropan-2-yl)-1,1-dioxo-1-benzothiophen-5-ol |
| PubChem CID | 117120895 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 3-(1-aminopropan-2-yl)-1,1-dioxo-1-benzothiophen-5-ol |
| SMILES | CC(CN)C1=CS(=O)(=O)c2ccc(O)cc21 |
| InChI | InChI=1S/C11H13NO3S/c1-7(5-12)10-6-16(14,15)11-3-2-8(13)4-9(10)11/h2-4,6-7,13H,5,12H2,1H3 |
| InChIKey | SLJFFRJIWCAVCH-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1-aminopropan-2-yl)-1,1-dioxo-1-benzothiophen-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-aminopropan-2-yl)-1,1-dioxo-1-benzothiophen-5-ol?
The IUPAC name of 3-(1-aminopropan-2-yl)-1,1-dioxo-1-benzothiophen-5-ol (CID 117120895) is 3-(1-aminopropan-2-yl)-1,1-dioxo-1-benzothiophen-5-ol.
What is the SMILES notation for 3-(1-aminopropan-2-yl)-1,1-dioxo-1-benzothiophen-5-ol?
The canonical SMILES for 3-(1-aminopropan-2-yl)-1,1-dioxo-1-benzothiophen-5-ol is CC(CN)C1=CS(=O)(=O)c2ccc(O)cc21.
What is the InChIKey of 3-(1-aminopropan-2-yl)-1,1-dioxo-1-benzothiophen-5-ol?
The InChIKey is SLJFFRJIWCAVCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3S/c1-7(5-12)10-6-16(14,15)11-3-2-8(13)4-9(10)11/h2-4,6-7,13H,5,12H2,1H3.
What are the key properties of 3-(1-aminopropan-2-yl)-1,1-dioxo-1-benzothiophen-5-ol?
3-(1-aminopropan-2-yl)-1,1-dioxo-1-benzothiophen-5-ol has a molecular weight of 239.30 g/mol, XLogP of 1.12, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-aminopropan-2-yl)-1,1-dioxo-1-benzothiophen-5-ol is sourced from PubChem (CID 117120895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).