C16H14O5S — CID 117177894
3-[(4-methoxyphenoxy)methyl]-1,1-dioxo-1-benzothiophen-6-ol (PubChem CID 117177894) has the molecular formula C16H14O5S and a molecular weight of 318.35 g/mol. Its IUPAC name is 3-[(4-methoxyphenoxy)methyl]-1,1-dioxo-1-benzothiophen-6-ol.
| Compound Name | 3-[(4-methoxyphenoxy)methyl]-1,1-dioxo-1-benzothiophen-6-ol |
|---|---|
| PubChem CID | 117177894 |
| Molecular Formula | C16H14O5S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 3-[(4-methoxyphenoxy)methyl]-1,1-dioxo-1-benzothiophen-6-ol |
| SMILES | COc1ccc(OCC2=CS(=O)(=O)c3cc(O)ccc32)cc1 |
| InChI | InChI=1S/C16H14O5S/c1-20-13-3-5-14(6-4-13)21-9-11-10-22(18,19)16-8-12(17)2-7-15(11)16/h2-8,10,17H,9H2,1H3 |
| InChIKey | AGNPHBMLCXFADG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |