C7H4BrNO4S — CID 130352017
5-bromo-2-hydroxy-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 130352017) has the molecular formula C7H4BrNO4S and a molecular weight of 278.08 g/mol. Its IUPAC name is 5-bromo-2-hydroxy-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 5-bromo-2-hydroxy-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 130352017 |
| Molecular Formula | C7H4BrNO4S |
| Molecular Weight | 278.08 g/mol |
| Exact Mass | 276.90 |
| IUPAC Name | 5-bromo-2-hydroxy-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | O=C1c2cc(Br)ccc2S(=O)(=O)N1O |
| InChI | InChI=1S/C7H4BrNO4S/c8-4-1-2-6-5(3-4)7(10)9(11)14(6,12)13/h1-3,11H |
| InChIKey | SNOLMQJBNCKDQB-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.08 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|