C9H8BrNO3S — CID 117196237
O-[(6-bromo-1,1-dioxo-1-benzothiophen-3-yl)methyl]hydroxylamine (PubChem CID 117196237) has the molecular formula C9H8BrNO3S and a molecular weight of 290.14 g/mol. Its IUPAC name is O-[(6-bromo-1,1-dioxo-1-benzothiophen-3-yl)methyl]hydroxylamine.
| Compound Name | O-[(6-bromo-1,1-dioxo-1-benzothiophen-3-yl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 117196237 |
| Molecular Formula | C9H8BrNO3S |
| Molecular Weight | 290.14 g/mol |
| Exact Mass | 288.94 |
| IUPAC Name | O-[(6-bromo-1,1-dioxo-1-benzothiophen-3-yl)methyl]hydroxylamine |
| SMILES | NOCC1=CS(=O)(=O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C9H8BrNO3S/c10-7-1-2-8-6(4-14-11)5-15(12,13)9(8)3-7/h1-3,5H,4,11H2 |
| InChIKey | VKFJGNGTHZOBQK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.14 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|