C12H11FO4S — CID 117119465
3-(4-fluoro-1,1-dioxo-1-benzothiophen-3-yl)butanoic acid (PubChem CID 117119465) has the molecular formula C12H11FO4S and a molecular weight of 270.28 g/mol. Its IUPAC name is 3-(4-fluoro-1,1-dioxo-1-benzothiophen-3-yl)butanoic acid.
| Compound Name | 3-(4-fluoro-1,1-dioxo-1-benzothiophen-3-yl)butanoic acid |
|---|---|
| PubChem CID | 117119465 |
| Molecular Formula | C12H11FO4S |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 3-(4-fluoro-1,1-dioxo-1-benzothiophen-3-yl)butanoic acid |
| SMILES | CC(CC(=O)O)C1=CS(=O)(=O)c2cccc(F)c21 |
| InChI | InChI=1S/C12H11FO4S/c1-7(5-11(14)15)8-6-18(16,17)10-4-2-3-9(13)12(8)10/h2-4,6-7H,5H2,1H3,(H,14,15) |
| InChIKey | DEXOUCOCFFJWCV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |