C11H11FN2O2 — CID 83910713
3-(4-fluoro-2H-indazol-3-yl)butanoic acid (PubChem CID 83910713) has the molecular formula C11H11FN2O2 and a molecular weight of 222.22 g/mol. Its IUPAC name is 3-(4-fluoro-2H-indazol-3-yl)butanoic acid.
| Compound Name | 3-(4-fluoro-2H-indazol-3-yl)butanoic acid |
|---|---|
| PubChem CID | 83910713 |
| Molecular Formula | C11H11FN2O2 |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 3-(4-fluoro-2H-indazol-3-yl)butanoic acid |
| SMILES | CC(CC(=O)O)c1[nH]nc2cccc(F)c12 |
| InChI | InChI=1S/C11H11FN2O2/c1-6(5-9(15)16)11-10-7(12)3-2-4-8(10)13-14-11/h2-4,6H,5H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | CUEWCQGHTWNGSK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |