2-(4-fluoro-1-methylindazol-3-yl)oxyacetic acid

C10H9FN2O3 — CID 84689003

IUPAC2-(4-fluoro-1-methylindazol-3-yl)oxyacetic acid
SMILESCn1nc(OCC(=O)O)c2c(F)cccc21
InChIInChI=1S/C10H9FN2O3/c1-13-7-4-2-3-6(11)9(7)10(12-13)16-5-8(14)15/h2-4H,5H2,1H3,(H,14,15)
InChIKeyRIGLPJXMNIBUGN-UHFFFAOYSA-N
MW224.19 g/mol
LogP1.18
Rot. Bonds3

About 2-(4-fluoro-1-methylindazol-3-yl)oxyacetic acid

2-(4-fluoro-1-methylindazol-3-yl)oxyacetic acid (PubChem CID 84689003) has the molecular formula C10H9FN2O3 and a molecular weight of 224.19 g/mol. Its IUPAC name is 2-(4-fluoro-1-methylindazol-3-yl)oxyacetic acid.

Molecular Properties

Compound Name2-(4-fluoro-1-methylindazol-3-yl)oxyacetic acid
PubChem CID84689003
Molecular FormulaC10H9FN2O3
Molecular Weight224.19 g/mol
Exact Mass224.06
IUPAC Name2-(4-fluoro-1-methylindazol-3-yl)oxyacetic acid
SMILESCn1nc(OCC(=O)O)c2c(F)cccc21
InChIInChI=1S/C10H9FN2O3/c1-13-7-4-2-3-6(11)9(7)10(12-13)16-5-8(14)15/h2-4H,5H2,1H3,(H,14,15)
InChIKeyRIGLPJXMNIBUGN-UHFFFAOYSA-N
XLogP1.18
TPSA64.35 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.19
LogP ≤ 51.18
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(4-fluoro-1-methylindazol-3-yl)oxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[(3-fluoro-2-pyridinyl)oxy]acetic acid
CID 66975791
2-(4-fluoro-3-methylindazol-2-yl)acetic acid
CID 84722585
4-fluoro-1-methylindazole-3-sulfonyl chloride
CID 19083160
2-[4-bromo-1-(2-fluorophenyl)-5-pyrimidin-5-ylpyrazol-3-yl]oxyacetic acid
CID 155368201
tributyl-(4-fluoro-1-methylindazol-3-yl)stannane
CID 174732024
4-fluoro-1-methoxyindazole-3-carboxylic acid
CID 67229837
cis-(1R,2S)-2-[(4-fluoro-1-methylindazol-3-yl)carbamoyl]cyclobutane-1-carboxylic acid
CID 6926869
3-methoxy-1-methylindazol-4-amine
CID 133061084
2-chloro-6-fluoro-N-(4-fluoro-1-methylindazol-3-yl)benzamide
CID 2742954
2-[3-(benzimidazol-1-yl)phenoxy]acetic acid
CID 82514442
2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyacetic acid
CID 175009930
2-[(6-bromo-3-fluoro-2-pyridinyl)oxy]acetic acid;ethane
CID 170702490

Frequently Asked Questions

What is the IUPAC name of 2-(4-fluoro-1-methylindazol-3-yl)oxyacetic acid?
The IUPAC name of 2-(4-fluoro-1-methylindazol-3-yl)oxyacetic acid (CID 84689003) is 2-(4-fluoro-1-methylindazol-3-yl)oxyacetic acid.
What is the SMILES notation for 2-(4-fluoro-1-methylindazol-3-yl)oxyacetic acid?
The canonical SMILES for 2-(4-fluoro-1-methylindazol-3-yl)oxyacetic acid is Cn1nc(OCC(=O)O)c2c(F)cccc21.
What is the InChIKey of 2-(4-fluoro-1-methylindazol-3-yl)oxyacetic acid?
The InChIKey is RIGLPJXMNIBUGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FN2O3/c1-13-7-4-2-3-6(11)9(7)10(12-13)16-5-8(14)15/h2-4H,5H2,1H3,(H,14,15).
What are the key properties of 2-(4-fluoro-1-methylindazol-3-yl)oxyacetic acid?
2-(4-fluoro-1-methylindazol-3-yl)oxyacetic acid has a molecular weight of 224.19 g/mol, XLogP of 1.18, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluoro-1-methylindazol-3-yl)oxyacetic acid is sourced from PubChem (CID 84689003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).