About 2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyacetic acid
2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyacetic acid (PubChem CID 175009930) has the molecular formula C9H9N3O3
and a molecular weight of 207.19 g/mol. Its IUPAC name is 2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyacetic acid.
Molecular Properties
| Compound Name | 2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyacetic acid |
| PubChem CID | 175009930 |
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyacetic acid |
| SMILES | Nc1c(OCC(=O)O)nn2ccccc12 |
| InChI | InChI=1S/C9H9N3O3/c10-8-6-3-1-2-4-12(6)11-9(8)15-5-7(13)14/h1-4H,5,10H2,(H,13,14) |
| InChIKey | PCSDXVXNINTSFX-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyacetic acid?
The IUPAC name of 2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyacetic acid (CID 175009930) is 2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyacetic acid.
What is the SMILES notation for 2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyacetic acid?
The canonical SMILES for 2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyacetic acid is Nc1c(OCC(=O)O)nn2ccccc12.
What is the InChIKey of 2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyacetic acid?
The InChIKey is PCSDXVXNINTSFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O3/c10-8-6-3-1-2-4-12(6)11-9(8)15-5-7(13)14/h1-4H,5,10H2,(H,13,14).
What are the key properties of 2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyacetic acid?
2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyacetic acid has a molecular weight of 207.19 g/mol, XLogP of 0.38, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyacetic acid is sourced from PubChem (CID 175009930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).