C9H11N3O5 — CID 175416298
1-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyethane-1,1,2,2-tetrol (PubChem CID 175416298) has the molecular formula C9H11N3O5 and a molecular weight of 241.20 g/mol. Its IUPAC name is 1-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyethane-1,1,2,2-tetrol.
| Compound Name | 1-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyethane-1,1,2,2-tetrol |
|---|---|
| PubChem CID | 175416298 |
| Molecular Formula | C9H11N3O5 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 1-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyethane-1,1,2,2-tetrol |
| SMILES | Nc1c(OC(O)(O)C(O)O)nn2ccccc12 |
| InChI | InChI=1S/C9H11N3O5/c10-6-5-3-1-2-4-12(5)11-7(6)17-9(15,16)8(13)14/h1-4,8,13-16H,10H2 |
| InChIKey | XHSQDTUVNGLDIC-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|