C13H19N3O3 — CID 121418957
2-[2-(2-ethoxyethoxy)ethoxy]pyrazolo[1,5-a]pyridin-3-amine (PubChem CID 121418957) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is 2-[2-(2-ethoxyethoxy)ethoxy]pyrazolo[1,5-a]pyridin-3-amine.
| Compound Name | 2-[2-(2-ethoxyethoxy)ethoxy]pyrazolo[1,5-a]pyridin-3-amine |
|---|---|
| PubChem CID | 121418957 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 2-[2-(2-ethoxyethoxy)ethoxy]pyrazolo[1,5-a]pyridin-3-amine |
| SMILES | CCOCCOCCOc1nn2ccccc2c1N |
| InChI | InChI=1S/C13H19N3O3/c1-2-17-7-8-18-9-10-19-13-12(14)11-5-3-4-6-16(11)15-13/h3-6H,2,7-10,14H2,1H3 |
| InChIKey | AWEAUHKJVSJBEJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|