C8H6F2O — CID 22667341
2-(2,3-difluorophenyl)acetaldehyde (PubChem CID 22667341) has the molecular formula C8H6F2O and a molecular weight of 156.13 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)acetaldehyde.
| Compound Name | 2-(2,3-difluorophenyl)acetaldehyde |
|---|---|
| PubChem CID | 22667341 |
| Molecular Formula | C8H6F2O |
| Molecular Weight | 156.13 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 2-(2,3-difluorophenyl)acetaldehyde |
| SMILES | O=CCc1cccc(F)c1F |
| InChI | InChI=1S/C8H6F2O/c9-7-3-1-2-6(4-5-11)8(7)10/h1-3,5H,4H2 |
| InChIKey | BICAEWXRAVHTHG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.13 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|