C11H10NO5S- — CID 71436364
2-(4-ethyl-1,1,3-trioxo-1,2-benzothiazol-2-yl)acetate (PubChem CID 71436364) has the molecular formula C11H10NO5S- and a molecular weight of 268.27 g/mol. Its IUPAC name is 2-(4-ethyl-1,1,3-trioxo-1,2-benzothiazol-2-yl)acetate.
| Compound Name | 2-(4-ethyl-1,1,3-trioxo-1,2-benzothiazol-2-yl)acetate |
|---|---|
| PubChem CID | 71436364 |
| Molecular Formula | C11H10NO5S- |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 2-(4-ethyl-1,1,3-trioxo-1,2-benzothiazol-2-yl)acetate |
| SMILES | CCc1cccc2c1C(=O)N(CC(=O)[O-])S2(=O)=O |
| InChI | InChI=1S/C11H11NO5S/c1-2-7-4-3-5-8-10(7)11(15)12(6-9(13)14)18(8,16)17/h3-5H,2,6H2,1H3,(H,13,14)/p-1 |
| InChIKey | MDEUAYBINJLMLD-UHFFFAOYSA-M |
| XLogP | -0.86 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |