C7H4N2O5S2 — CID 141013282
2,2,11,11-tetraoxo-2λ6,11λ6-dithia-1,3-diazatricyclo[6.2.1.04,9]undeca-4(9),5,7-trien-10-one (PubChem CID 141013282) has the molecular formula C7H4N2O5S2 and a molecular weight of 260.25 g/mol. Its IUPAC name is 2,2,11,11-tetraoxo-2λ6,11λ6-dithia-1,3-diazatricyclo[6.2.1.04,9]undeca-4(9),5,7-trien-10-one.
| Compound Name | 2,2,11,11-tetraoxo-2λ6,11λ6-dithia-1,3-diazatricyclo[6.2.1.04,9]undeca-4(9),5,7-trien-10-one |
|---|---|
| PubChem CID | 141013282 |
| Molecular Formula | C7H4N2O5S2 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 259.96 |
| IUPAC Name | 2,2,11,11-tetraoxo-2λ6,11λ6-dithia-1,3-diazatricyclo[6.2.1.04,9]undeca-4(9),5,7-trien-10-one |
| SMILES | O=C1c2c3cccc2S(=O)(=O)N1S(=O)(=O)N3 |
| InChI | InChI=1S/C7H4N2O5S2/c10-7-6-4-2-1-3-5(6)15(11,12)9(7)16(13,14)8-4/h1-3,8H |
| InChIKey | AIUQEAURYMORKQ-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |