C12H16N2O3S — CID 117003893
2-tert-butyl-4-(methylamino)-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 117003893) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is 2-tert-butyl-4-(methylamino)-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 2-tert-butyl-4-(methylamino)-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 117003893 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 2-tert-butyl-4-(methylamino)-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | CNc1cccc2c1C(=O)N(C(C)(C)C)S2(=O)=O |
| InChI | InChI=1S/C12H16N2O3S/c1-12(2,3)14-11(15)10-8(13-4)6-5-7-9(10)18(14,16)17/h5-7,13H,1-4H3 |
| InChIKey | YGBAUYOUGLUJOM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |