C14H13BrS — CID 139447500
1-bromo-5,5-dimethyldibenzothiophene (PubChem CID 139447500) has the molecular formula C14H13BrS and a molecular weight of 293.23 g/mol. Its IUPAC name is 1-bromo-5,5-dimethyldibenzothiophene.
| Compound Name | 1-bromo-5,5-dimethyldibenzothiophene |
|---|---|
| PubChem CID | 139447500 |
| Molecular Formula | C14H13BrS |
| Molecular Weight | 293.23 g/mol |
| Exact Mass | 291.99 |
| IUPAC Name | 1-bromo-5,5-dimethyldibenzothiophene |
| SMILES | CS1(C)c2ccccc2-c2c(Br)cccc21 |
| InChI | InChI=1S/C14H13BrS/c1-16(2)12-8-4-3-6-10(12)14-11(15)7-5-9-13(14)16/h3-9H,1-2H3 |
| InChIKey | AVGNAYXZEJNFJB-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.23 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |