C8H4BrN3S — CID 18778688
5-(2-bromophenyl)-1,2,4-triazole-3-thione (PubChem CID 18778688) has the molecular formula C8H4BrN3S and a molecular weight of 254.11 g/mol. Its IUPAC name is 5-(2-bromophenyl)-1,2,4-triazole-3-thione.
| Compound Name | 5-(2-bromophenyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 18778688 |
| Molecular Formula | C8H4BrN3S |
| Molecular Weight | 254.11 g/mol |
| Exact Mass | 252.93 |
| IUPAC Name | 5-(2-bromophenyl)-1,2,4-triazole-3-thione |
| SMILES | S=C1N=NC(c2ccccc2Br)=N1 |
| InChI | InChI=1S/C8H4BrN3S/c9-6-4-2-1-3-5(6)7-10-8(13)12-11-7/h1-4H |
| InChIKey | ZBIRYJOJTGHJLT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.11 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|